C22H28N6O4 — CID 163472546
11-[[3-(2-ethyl-5-methylpyrazol-3-yl)oxiran-2-yl]amino]-2,6-dioxa-10,12-diazatricyclo[8.6.1.013,17]heptadeca-1(16),11,13(17),14-tetraene-15-carboxamide (PubChem CID 163472546) has the molecular formula C22H28N6O4 and a molecular weight of 440.50 g/mol. Its IUPAC name is 11-[[3-(2-ethyl-5-methylpyrazol-3-yl)oxiran-2-yl]amino]-2,6-dioxa-10,12-diazatricyclo[8.6.1.013,17]heptadeca-1(16),11,13(17),14-tetraene-15-carboxamide.
| Compound Name | 11-[[3-(2-ethyl-5-methylpyrazol-3-yl)oxiran-2-yl]amino]-2,6-dioxa-10,12-diazatricyclo[8.6.1.013,17]heptadeca-1(16),11,13(17),14-tetraene-15-carboxamide |
|---|---|
| PubChem CID | 163472546 |
| Molecular Formula | C22H28N6O4 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | 11-[[3-(2-ethyl-5-methylpyrazol-3-yl)oxiran-2-yl]amino]-2,6-dioxa-10,12-diazatricyclo[8.6.1.013,17]heptadeca-1(16),11,13(17),14-tetraene-15-carboxamide |
| SMILES | CCn1nc(C)cc1C1OC1Nc1nc2cc(C(N)=O)cc3c2n1CCCOCCCO3 |
| InChI | InChI=1S/C22H28N6O4/c1-3-28-16(10-13(2)26-28)19-21(32-19)25-22-24-15-11-14(20(23)29)12-17-18(15)27(22)6-4-7-30-8-5-9-31-17/h10-12,19,21H,3-9H2,1-2H3,(H2,23,29)(H,24,25) |
| InChIKey | BXSHZYLRYOMTIS-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 121.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|