C20H23N7O — CID 146416190
N-(6-cyano-11,11-dimethyl-1,3,9-triazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraen-2-yl)-2-ethyl-5-methylpyrazole-3-carboxamide (PubChem CID 146416190) has the molecular formula C20H23N7O and a molecular weight of 377.45 g/mol. Its IUPAC name is N-(6-cyano-11,11-dimethyl-1,3,9-triazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraen-2-yl)-2-ethyl-5-methylpyrazole-3-carboxamide.
| Compound Name | N-(6-cyano-11,11-dimethyl-1,3,9-triazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraen-2-yl)-2-ethyl-5-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 146416190 |
| Molecular Formula | C20H23N7O |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | N-(6-cyano-11,11-dimethyl-1,3,9-triazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraen-2-yl)-2-ethyl-5-methylpyrazole-3-carboxamide |
| SMILES | CCn1nc(C)cc1C(=O)Nc1nc2cc(C#N)cc3c2n1CC(C)(C)CN3 |
| InChI | InChI=1S/C20H23N7O/c1-5-27-16(6-12(2)25-27)18(28)24-19-23-15-8-13(9-21)7-14-17(15)26(19)11-20(3,4)10-22-14/h6-8,22H,5,10-11H2,1-4H3,(H,23,24,28) |
| InChIKey | IMVYXMFHDVOOMJ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 100.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |