C11H23NO2 — CID 146416839
N-ethyl-3-hydroxy-2-methyl-N-(2-methylbutan-2-yl)propanamide (PubChem CID 146416839) has the molecular formula C11H23NO2 and a molecular weight of 201.31 g/mol. Its IUPAC name is N-ethyl-3-hydroxy-2-methyl-N-(2-methylbutan-2-yl)propanamide.
| Compound Name | N-ethyl-3-hydroxy-2-methyl-N-(2-methylbutan-2-yl)propanamide |
|---|---|
| PubChem CID | 146416839 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | N-ethyl-3-hydroxy-2-methyl-N-(2-methylbutan-2-yl)propanamide |
| SMILES | CCN(C(=O)C(C)CO)C(C)(C)CC |
| InChI | InChI=1S/C11H23NO2/c1-6-11(4,5)12(7-2)10(14)9(3)8-13/h9,13H,6-8H2,1-5H3 |
| InChIKey | HOBOFZXQYMOADQ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |