C24H24FN5O4S — CID 146416951
2-[[4-(2,6-dimethoxyphenyl)-5-(6-methoxy-2-pyridinyl)-1,2,4-triazol-3-yl]amino]sulfanyl-1-(4-fluorophenyl)ethanol (PubChem CID 146416951) has the molecular formula C24H24FN5O4S and a molecular weight of 497.55 g/mol. Its IUPAC name is 2-[[4-(2,6-dimethoxyphenyl)-5-(6-methoxy-2-pyridinyl)-1,2,4-triazol-3-yl]amino]sulfanyl-1-(4-fluorophenyl)ethanol.
| Compound Name | 2-[[4-(2,6-dimethoxyphenyl)-5-(6-methoxy-2-pyridinyl)-1,2,4-triazol-3-yl]amino]sulfanyl-1-(4-fluorophenyl)ethanol |
|---|---|
| PubChem CID | 146416951 |
| Molecular Formula | C24H24FN5O4S |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.15 |
| IUPAC Name | 2-[[4-(2,6-dimethoxyphenyl)-5-(6-methoxy-2-pyridinyl)-1,2,4-triazol-3-yl]amino]sulfanyl-1-(4-fluorophenyl)ethanol |
| SMILES | COc1cccc(-c2nnc(NSCC(O)c3ccc(F)cc3)n2-c2c(OC)cccc2OC)n1 |
| InChI | InChI=1S/C24H24FN5O4S/c1-32-19-7-5-8-20(33-2)22(19)30-23(17-6-4-9-21(26-17)34-3)27-28-24(30)29-35-14-18(31)15-10-12-16(25)13-11-15/h4-13,18,31H,14H2,1-3H3,(H,28,29) |
| InChIKey | XMSVLBCEDOJINJ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 103.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|