C22H35N3O3 — CID 146417264
tert-butyl (3R)-3-[4-[(2R)-5-methyl-1,2,3,4-tetrahydro-1,8-naphthyridin-2-yl]butoxy]pyrrolidine-1-carboxylate (PubChem CID 146417264) has the molecular formula C22H35N3O3 and a molecular weight of 389.54 g/mol. Its IUPAC name is tert-butyl (3R)-3-[4-[(2R)-5-methyl-1,2,3,4-tetrahydro-1,8-naphthyridin-2-yl]butoxy]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[4-[(2R)-5-methyl-1,2,3,4-tetrahydro-1,8-naphthyridin-2-yl]butoxy]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 146417264 |
| Molecular Formula | C22H35N3O3 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.27 |
| IUPAC Name | tert-butyl (3R)-3-[4-[(2R)-5-methyl-1,2,3,4-tetrahydro-1,8-naphthyridin-2-yl]butoxy]pyrrolidine-1-carboxylate |
| SMILES | Cc1ccnc2c1CC[C@@H](CCCCO[C@@H]1CCN(C(=O)OC(C)(C)C)C1)N2 |
| InChI | InChI=1S/C22H35N3O3/c1-16-10-12-23-20-19(16)9-8-17(24-20)7-5-6-14-27-18-11-13-25(15-18)21(26)28-22(2,3)4/h10,12,17-18H,5-9,11,13-15H2,1-4H3,(H,23,24)/t17-,18-/m1/s1 |
| InChIKey | HOJLAHYXENSCSN-QZTJIDSGSA-N |
| XLogP | 4.31 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|