C21H28ClN3O3 — CID 175125856
tert-butyl (3R)-3-[4-(4-chloro-1,5-naphthyridin-2-yl)butoxy]pyrrolidine-1-carboxylate (PubChem CID 175125856) has the molecular formula C21H28ClN3O3 and a molecular weight of 405.93 g/mol. Its IUPAC name is tert-butyl (3R)-3-[4-(4-chloro-1,5-naphthyridin-2-yl)butoxy]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[4-(4-chloro-1,5-naphthyridin-2-yl)butoxy]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 175125856 |
| Molecular Formula | C21H28ClN3O3 |
| Molecular Weight | 405.93 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | tert-butyl (3R)-3-[4-(4-chloro-1,5-naphthyridin-2-yl)butoxy]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](OCCCCc2cc(Cl)c3ncccc3n2)C1 |
| InChI | InChI=1S/C21H28ClN3O3/c1-21(2,3)28-20(26)25-11-9-16(14-25)27-12-5-4-7-15-13-17(22)19-18(24-15)8-6-10-23-19/h6,8,10,13,16H,4-5,7,9,11-12,14H2,1-3H3/t16-/m1/s1 |
| InChIKey | KULCYFRXKLYDKA-MRXNPFEDSA-N |
| XLogP | 4.63 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.93 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|