C23H31F2N3O3 — CID 146425671
tert-butyl 3-[1,1-difluoro-5-(4-methoxy-1,8-naphthyridin-2-yl)pentyl]pyrrolidine-1-carboxylate (PubChem CID 146425671) has the molecular formula C23H31F2N3O3 and a molecular weight of 435.52 g/mol. Its IUPAC name is tert-butyl 3-[1,1-difluoro-5-(4-methoxy-1,8-naphthyridin-2-yl)pentyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[1,1-difluoro-5-(4-methoxy-1,8-naphthyridin-2-yl)pentyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 146425671 |
| Molecular Formula | C23H31F2N3O3 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | tert-butyl 3-[1,1-difluoro-5-(4-methoxy-1,8-naphthyridin-2-yl)pentyl]pyrrolidine-1-carboxylate |
| SMILES | COc1cc(CCCCC(F)(F)C2CCN(C(=O)OC(C)(C)C)C2)nc2ncccc12 |
| InChI | InChI=1S/C23H31F2N3O3/c1-22(2,3)31-21(29)28-13-10-16(15-28)23(24,25)11-6-5-8-17-14-19(30-4)18-9-7-12-26-20(18)27-17/h7,9,12,14,16H,5-6,8,10-11,13,15H2,1-4H3 |
| InChIKey | DFSDCUXSTNWMQC-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|