C24H36N2O4 — CID 146433719
tert-butyl 3-[(E)-7-methoxy-5-methylidene-7-(2-methyl-3-pyridinyl)hept-6-enoxy]pyrrolidine-1-carboxylate (PubChem CID 146433719) has the molecular formula C24H36N2O4 and a molecular weight of 416.56 g/mol. Its IUPAC name is tert-butyl 3-[(E)-7-methoxy-5-methylidene-7-(2-methyl-3-pyridinyl)hept-6-enoxy]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(E)-7-methoxy-5-methylidene-7-(2-methyl-3-pyridinyl)hept-6-enoxy]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 146433719 |
| Molecular Formula | C24H36N2O4 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.27 |
| IUPAC Name | tert-butyl 3-[(E)-7-methoxy-5-methylidene-7-(2-methyl-3-pyridinyl)hept-6-enoxy]pyrrolidine-1-carboxylate |
| SMILES | C=C(/C=C(/OC)c1cccnc1C)CCCCOC1CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C24H36N2O4/c1-18(16-22(28-6)21-11-9-13-25-19(21)2)10-7-8-15-29-20-12-14-26(17-20)23(27)30-24(3,4)5/h9,11,13,16,20H,1,7-8,10,12,14-15,17H2,2-6H3/b22-16+ |
| InChIKey | RCTWHEDTBQDARE-CJLVFECKSA-N |
| XLogP | 5.13 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|