C25H41N3O3 — CID 142280893
tert-butyl 4-[4-[[(E)-3-(2-methyl-3-pyridinyl)prop-2-enoyl]amino]butyl]piperidine-1-carboxylate;ethane (PubChem CID 142280893) has the molecular formula C25H41N3O3 and a molecular weight of 431.62 g/mol. Its IUPAC name is tert-butyl 4-[4-[[(E)-3-(2-methyl-3-pyridinyl)prop-2-enoyl]amino]butyl]piperidine-1-carboxylate;ethane.
| Compound Name | tert-butyl 4-[4-[[(E)-3-(2-methyl-3-pyridinyl)prop-2-enoyl]amino]butyl]piperidine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 142280893 |
| Molecular Formula | C25H41N3O3 |
| Molecular Weight | 431.62 g/mol |
| Exact Mass | 431.31 |
| IUPAC Name | tert-butyl 4-[4-[[(E)-3-(2-methyl-3-pyridinyl)prop-2-enoyl]amino]butyl]piperidine-1-carboxylate;ethane |
| SMILES | CC.Cc1ncccc1/C=C/C(=O)NCCCCC1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C23H35N3O3.C2H6/c1-18-20(9-7-15-24-18)10-11-21(27)25-14-6-5-8-19-12-16-26(17-13-19)22(28)29-23(2,3)4;1-2/h7,9-11,15,19H,5-6,8,12-14,16-17H2,1-4H3,(H,25,27);1-2H3/b11-10+; |
| InChIKey | VORLBBMZZYUCPH-ASTDGNLGSA-N |
| XLogP | 5.36 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.62 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|