C23H36N4O4 — CID 169317854
tert-butyl 4-[4-[(4-carbamoylphenyl)methylcarbamoylamino]butyl]piperidine-1-carboxylate (PubChem CID 169317854) has the molecular formula C23H36N4O4 and a molecular weight of 432.57 g/mol. Its IUPAC name is tert-butyl 4-[4-[(4-carbamoylphenyl)methylcarbamoylamino]butyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[(4-carbamoylphenyl)methylcarbamoylamino]butyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 169317854 |
| Molecular Formula | C23H36N4O4 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | tert-butyl 4-[4-[(4-carbamoylphenyl)methylcarbamoylamino]butyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CCCCNC(=O)NCc2ccc(C(N)=O)cc2)CC1 |
| InChI | InChI=1S/C23H36N4O4/c1-23(2,3)31-22(30)27-14-11-17(12-15-27)6-4-5-13-25-21(29)26-16-18-7-9-19(10-8-18)20(24)28/h7-10,17H,4-6,11-16H2,1-3H3,(H2,24,28)(H2,25,26,29) |
| InChIKey | LGKUEZPRVYVPOR-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|