C23H33ClN4O3 — CID 166834749
1-[(4-chlorophenyl)methyl]-3-[4-[1-(1-methyl-5-oxopyrrolidine-3-carbonyl)piperidin-4-yl]butyl]urea (PubChem CID 166834749) has the molecular formula C23H33ClN4O3 and a molecular weight of 449.00 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-3-[4-[1-(1-methyl-5-oxopyrrolidine-3-carbonyl)piperidin-4-yl]butyl]urea.
| Compound Name | 1-[(4-chlorophenyl)methyl]-3-[4-[1-(1-methyl-5-oxopyrrolidine-3-carbonyl)piperidin-4-yl]butyl]urea |
|---|---|
| PubChem CID | 166834749 |
| Molecular Formula | C23H33ClN4O3 |
| Molecular Weight | 449.00 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-3-[4-[1-(1-methyl-5-oxopyrrolidine-3-carbonyl)piperidin-4-yl]butyl]urea |
| SMILES | CN1CC(C(=O)N2CCC(CCCCNC(=O)NCc3ccc(Cl)cc3)CC2)CC1=O |
| InChI | InChI=1S/C23H33ClN4O3/c1-27-16-19(14-21(27)29)22(30)28-12-9-17(10-13-28)4-2-3-11-25-23(31)26-15-18-5-7-20(24)8-6-18/h5-8,17,19H,2-4,9-16H2,1H3,(H2,25,26,31) |
| InChIKey | IUKQLZCANLUWTG-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.00 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|