C25H30ClF2N3O2 — CID 166834783
1-[(4-chlorophenyl)methyl]-3-[4-[1-[2-(difluoromethyl)benzoyl]piperidin-4-yl]butyl]urea (PubChem CID 166834783) has the molecular formula C25H30ClF2N3O2 and a molecular weight of 477.98 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-3-[4-[1-[2-(difluoromethyl)benzoyl]piperidin-4-yl]butyl]urea.
| Compound Name | 1-[(4-chlorophenyl)methyl]-3-[4-[1-[2-(difluoromethyl)benzoyl]piperidin-4-yl]butyl]urea |
|---|---|
| PubChem CID | 166834783 |
| Molecular Formula | C25H30ClF2N3O2 |
| Molecular Weight | 477.98 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-3-[4-[1-[2-(difluoromethyl)benzoyl]piperidin-4-yl]butyl]urea |
| SMILES | O=C(NCCCCC1CCN(C(=O)c2ccccc2C(F)F)CC1)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H30ClF2N3O2/c26-20-10-8-19(9-11-20)17-30-25(33)29-14-4-3-5-18-12-15-31(16-13-18)24(32)22-7-2-1-6-21(22)23(27)28/h1-2,6-11,18,23H,3-5,12-17H2,(H2,29,30,33) |
| InChIKey | YPXNZNWCTRYINT-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.98 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|