About octyl 4-hydroxybenzoate
octyl 4-hydroxybenzoate (PubChem CID 14642) has the molecular formula C15H22O3
and a molecular weight of 250.34 g/mol. Its IUPAC name is octyl 4-hydroxybenzoate.
Molecular Properties
| Compound Name | octyl 4-hydroxybenzoate |
| PubChem CID | 14642 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | octyl 4-hydroxybenzoate |
| SMILES | CCCCCCCCOC(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C15H22O3/c1-2-3-4-5-6-7-12-18-15(17)13-8-10-14(16)11-9-13/h8-11,16H,2-7,12H2,1H3 |
| InChIKey | RIKCMEDSBFQFAL-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze octyl 4-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octyl 4-hydroxybenzoate?
The IUPAC name of octyl 4-hydroxybenzoate (CID 14642) is octyl 4-hydroxybenzoate.
What is the SMILES notation for octyl 4-hydroxybenzoate?
The canonical SMILES for octyl 4-hydroxybenzoate is CCCCCCCCOC(=O)c1ccc(O)cc1.
What is the InChIKey of octyl 4-hydroxybenzoate?
The InChIKey is RIKCMEDSBFQFAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O3/c1-2-3-4-5-6-7-12-18-15(17)13-8-10-14(16)11-9-13/h8-11,16H,2-7,12H2,1H3.
What are the key properties of octyl 4-hydroxybenzoate?
octyl 4-hydroxybenzoate has a molecular weight of 250.34 g/mol, XLogP of 3.91, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for octyl 4-hydroxybenzoate is sourced from PubChem (CID 14642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).