About N-ethoxyformamide;ethyl (4-methylphenyl) carbonate
N-ethoxyformamide;ethyl (4-methylphenyl) carbonate (PubChem CID 146420977) has the molecular formula C13H19NO5
and a molecular weight of 269.30 g/mol. Its IUPAC name is N-ethoxyformamide;ethyl (4-methylphenyl) carbonate.
Molecular Properties
| Compound Name | N-ethoxyformamide;ethyl (4-methylphenyl) carbonate |
| PubChem CID | 146420977 |
| Molecular Formula | C13H19NO5 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | N-ethoxyformamide;ethyl (4-methylphenyl) carbonate |
| SMILES | CCOC(=O)Oc1ccc(C)cc1.CCONC=O |
| InChI | InChI=1S/C10H12O3.C3H7NO2/c1-3-12-10(11)13-9-6-4-8(2)5-7-9;1-2-6-4-3-5/h4-7H,3H2,1-2H3;3H,2H2,1H3,(H,4,5) |
| InChIKey | SJBKFAKMUCDSMJ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze N-ethoxyformamide;ethyl (4-methylphenyl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethoxyformamide;ethyl (4-methylphenyl) carbonate?
The IUPAC name of N-ethoxyformamide;ethyl (4-methylphenyl) carbonate (CID 146420977) is N-ethoxyformamide;ethyl (4-methylphenyl) carbonate.
What is the SMILES notation for N-ethoxyformamide;ethyl (4-methylphenyl) carbonate?
The canonical SMILES for N-ethoxyformamide;ethyl (4-methylphenyl) carbonate is CCOC(=O)Oc1ccc(C)cc1.CCONC=O.
What is the InChIKey of N-ethoxyformamide;ethyl (4-methylphenyl) carbonate?
The InChIKey is SJBKFAKMUCDSMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3.C3H7NO2/c1-3-12-10(11)13-9-6-4-8(2)5-7-9;1-2-6-4-3-5/h4-7H,3H2,1-2H3;3H,2H2,1H3,(H,4,5).
What are the key properties of N-ethoxyformamide;ethyl (4-methylphenyl) carbonate?
N-ethoxyformamide;ethyl (4-methylphenyl) carbonate has a molecular weight of 269.30 g/mol, XLogP of 2.21, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethoxyformamide;ethyl (4-methylphenyl) carbonate is sourced from PubChem (CID 146420977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).