C20H16F5N3O4S — CID 146421904
N-[(2,4-dimethoxyphenyl)methyl]-5-fluoro-N-(6-fluoro-2-pyridinyl)-4-(trifluoromethyl)pyridine-2-sulfonamide (PubChem CID 146421904) has the molecular formula C20H16F5N3O4S and a molecular weight of 489.42 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methyl]-5-fluoro-N-(6-fluoro-2-pyridinyl)-4-(trifluoromethyl)pyridine-2-sulfonamide.
| Compound Name | N-[(2,4-dimethoxyphenyl)methyl]-5-fluoro-N-(6-fluoro-2-pyridinyl)-4-(trifluoromethyl)pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 146421904 |
| Molecular Formula | C20H16F5N3O4S |
| Molecular Weight | 489.42 g/mol |
| Exact Mass | 489.08 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methyl]-5-fluoro-N-(6-fluoro-2-pyridinyl)-4-(trifluoromethyl)pyridine-2-sulfonamide |
| SMILES | COc1ccc(CN(c2cccc(F)n2)S(=O)(=O)c2cc(C(F)(F)F)c(F)cn2)c(OC)c1 |
| InChI | InChI=1S/C20H16F5N3O4S/c1-31-13-7-6-12(16(8-13)32-2)11-28(18-5-3-4-17(22)27-18)33(29,30)19-9-14(20(23,24)25)15(21)10-26-19/h3-10H,11H2,1-2H3 |
| InChIKey | APUCTMXBJGUWJJ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 81.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.42 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|