C18H14ClF2N3O3S — CID 146421712
5-chloro-6-fluoro-N-(6-fluoro-2-pyridinyl)-N-[(4-methoxyphenyl)methyl]pyridine-3-sulfonamide (PubChem CID 146421712) has the molecular formula C18H14ClF2N3O3S and a molecular weight of 425.84 g/mol. Its IUPAC name is 5-chloro-6-fluoro-N-(6-fluoro-2-pyridinyl)-N-[(4-methoxyphenyl)methyl]pyridine-3-sulfonamide.
| Compound Name | 5-chloro-6-fluoro-N-(6-fluoro-2-pyridinyl)-N-[(4-methoxyphenyl)methyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 146421712 |
| Molecular Formula | C18H14ClF2N3O3S |
| Molecular Weight | 425.84 g/mol |
| Exact Mass | 425.04 |
| IUPAC Name | 5-chloro-6-fluoro-N-(6-fluoro-2-pyridinyl)-N-[(4-methoxyphenyl)methyl]pyridine-3-sulfonamide |
| SMILES | COc1ccc(CN(c2cccc(F)n2)S(=O)(=O)c2cnc(F)c(Cl)c2)cc1 |
| InChI | InChI=1S/C18H14ClF2N3O3S/c1-27-13-7-5-12(6-8-13)11-24(17-4-2-3-16(20)23-17)28(25,26)14-9-15(19)18(21)22-10-14/h2-10H,11H2,1H3 |
| InChIKey | WMWFWRDKARLTCN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.84 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|