C22H22N4O3 — CID 146423449
(3S)-3-[3-(4-cyanoanilino)-4-(1-methylpyrazol-4-yl)phenyl]-4-methoxybutanoic acid (PubChem CID 146423449) has the molecular formula C22H22N4O3 and a molecular weight of 390.44 g/mol. Its IUPAC name is (3S)-3-[3-(4-cyanoanilino)-4-(1-methylpyrazol-4-yl)phenyl]-4-methoxybutanoic acid.
| Compound Name | (3S)-3-[3-(4-cyanoanilino)-4-(1-methylpyrazol-4-yl)phenyl]-4-methoxybutanoic acid |
|---|---|
| PubChem CID | 146423449 |
| Molecular Formula | C22H22N4O3 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | (3S)-3-[3-(4-cyanoanilino)-4-(1-methylpyrazol-4-yl)phenyl]-4-methoxybutanoic acid |
| SMILES | COC[C@@H](CC(=O)O)c1ccc(-c2cnn(C)c2)c(Nc2ccc(C#N)cc2)c1 |
| InChI | InChI=1S/C22H22N4O3/c1-26-13-18(12-24-26)20-8-5-16(17(14-29-2)10-22(27)28)9-21(20)25-19-6-3-15(11-23)4-7-19/h3-9,12-13,17,25H,10,14H2,1-2H3,(H,27,28)/t17-/m1/s1 |
| InChIKey | AZNSPMUTISDBSU-QGZVFWFLSA-N |
| XLogP | 3.91 |
| TPSA | 100.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |