C25H22N2O5 — CID 146423416
3-[4-(1,3-benzodioxol-5-yl)-3-(4-cyanoanilino)phenyl]-4-methoxybutanoic acid (PubChem CID 146423416) has the molecular formula C25H22N2O5 and a molecular weight of 430.46 g/mol. Its IUPAC name is 3-[4-(1,3-benzodioxol-5-yl)-3-(4-cyanoanilino)phenyl]-4-methoxybutanoic acid.
| Compound Name | 3-[4-(1,3-benzodioxol-5-yl)-3-(4-cyanoanilino)phenyl]-4-methoxybutanoic acid |
|---|---|
| PubChem CID | 146423416 |
| Molecular Formula | C25H22N2O5 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | 3-[4-(1,3-benzodioxol-5-yl)-3-(4-cyanoanilino)phenyl]-4-methoxybutanoic acid |
| SMILES | COCC(CC(=O)O)c1ccc(-c2ccc3c(c2)OCO3)c(Nc2ccc(C#N)cc2)c1 |
| InChI | InChI=1S/C25H22N2O5/c1-30-14-19(12-25(28)29)17-4-8-21(18-5-9-23-24(11-18)32-15-31-23)22(10-17)27-20-6-2-16(13-26)3-7-20/h2-11,19,27H,12,14-15H2,1H3,(H,28,29) |
| InChIKey | ADGHTUYJFLBIAZ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 100.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |