C21H26BrFN8O4 — CID 146427660
[4-[3-[[amino-(cyclohexanecarbonylamino)methylidene]amino]propylamino]-1,2,5-oxadiazole-3-carboximidoyl]-(3-bromo-4-fluorophenyl)carbamic acid (PubChem CID 146427660) has the molecular formula C21H26BrFN8O4 and a molecular weight of 553.39 g/mol. Its IUPAC name is [4-[3-[[amino-(cyclohexanecarbonylamino)methylidene]amino]propylamino]-1,2,5-oxadiazole-3-carboximidoyl]-(3-bromo-4-fluorophenyl)carbamic acid.
| Compound Name | [4-[3-[[amino-(cyclohexanecarbonylamino)methylidene]amino]propylamino]-1,2,5-oxadiazole-3-carboximidoyl]-(3-bromo-4-fluorophenyl)carbamic acid |
|---|---|
| PubChem CID | 146427660 |
| Molecular Formula | C21H26BrFN8O4 |
| Molecular Weight | 553.39 g/mol |
| Exact Mass | 552.12 |
| IUPAC Name | [4-[3-[[amino-(cyclohexanecarbonylamino)methylidene]amino]propylamino]-1,2,5-oxadiazole-3-carboximidoyl]-(3-bromo-4-fluorophenyl)carbamic acid |
| SMILES | [H]/N=C(\c1nonc1NCCC/N=C(\N)NC(=O)C1CCCCC1)N(C(=O)O)c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C21H26BrFN8O4/c22-14-11-13(7-8-15(14)23)31(21(33)34)17(24)16-18(30-35-29-16)26-9-4-10-27-20(25)28-19(32)12-5-2-1-3-6-12/h7-8,11-12,24H,1-6,9-10H2,(H,26,30)(H,33,34)(H3,25,27,28,32)/b24-17+ |
| InChIKey | ZGLLFNVZIOPVMX-JJIBRWJFSA-N |
| XLogP | 3.29 |
| TPSA | 182.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.39 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|