C14H14BrFN8O3 — CID 146427741
2-[3-[[4-[4-(3-bromo-4-fluorophenyl)-5-oxo-1,2,4-oxadiazol-3-yl]-1,2,5-oxadiazol-3-yl]amino]propyl]guanidine (PubChem CID 146427741) has the molecular formula C14H14BrFN8O3 and a molecular weight of 441.22 g/mol. Its IUPAC name is 2-[3-[[4-[4-(3-bromo-4-fluorophenyl)-5-oxo-1,2,4-oxadiazol-3-yl]-1,2,5-oxadiazol-3-yl]amino]propyl]guanidine.
| Compound Name | 2-[3-[[4-[4-(3-bromo-4-fluorophenyl)-5-oxo-1,2,4-oxadiazol-3-yl]-1,2,5-oxadiazol-3-yl]amino]propyl]guanidine |
|---|---|
| PubChem CID | 146427741 |
| Molecular Formula | C14H14BrFN8O3 |
| Molecular Weight | 441.22 g/mol |
| Exact Mass | 440.04 |
| IUPAC Name | 2-[3-[[4-[4-(3-bromo-4-fluorophenyl)-5-oxo-1,2,4-oxadiazol-3-yl]-1,2,5-oxadiazol-3-yl]amino]propyl]guanidine |
| SMILES | NC(N)=NCCCNc1nonc1-c1noc(=O)n1-c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C14H14BrFN8O3/c15-8-6-7(2-3-9(8)16)24-12(23-26-14(24)25)10-11(22-27-21-10)19-4-1-5-20-13(17)18/h2-3,6H,1,4-5H2,(H,19,22)(H4,17,18,20) |
| InChIKey | NGFDWKMCBGCRBA-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 163.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.22 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|