C36H53FN2O4 — CID 146431684
tert-butyl 2-[3-[(Z)-7-(2,6-dimethyl-1,2,3,4-tetrahydropyridin-5-yl)-5-methylidenehept-6-enoxy]pyrrolidin-1-yl]-2-[5-fluoro-2-(oxan-2-yl)phenyl]acetate (PubChem CID 146431684) has the molecular formula C36H53FN2O4 and a molecular weight of 596.83 g/mol. Its IUPAC name is tert-butyl 2-[3-[(Z)-7-(2,6-dimethyl-1,2,3,4-tetrahydropyridin-5-yl)-5-methylidenehept-6-enoxy]pyrrolidin-1-yl]-2-[5-fluoro-2-(oxan-2-yl)phenyl]acetate.
| Compound Name | tert-butyl 2-[3-[(Z)-7-(2,6-dimethyl-1,2,3,4-tetrahydropyridin-5-yl)-5-methylidenehept-6-enoxy]pyrrolidin-1-yl]-2-[5-fluoro-2-(oxan-2-yl)phenyl]acetate |
|---|---|
| PubChem CID | 146431684 |
| Molecular Formula | C36H53FN2O4 |
| Molecular Weight | 596.83 g/mol |
| Exact Mass | 596.40 |
| IUPAC Name | tert-butyl 2-[3-[(Z)-7-(2,6-dimethyl-1,2,3,4-tetrahydropyridin-5-yl)-5-methylidenehept-6-enoxy]pyrrolidin-1-yl]-2-[5-fluoro-2-(oxan-2-yl)phenyl]acetate |
| SMILES | C=C(/C=C\C1=C(C)NC(C)CC1)CCCCOC1CCN(C(C(=O)OC(C)(C)C)c2cc(F)ccc2C2CCCCO2)C1 |
| InChI | InChI=1S/C36H53FN2O4/c1-25(13-15-28-16-14-26(2)38-27(28)3)11-7-9-21-41-30-19-20-39(24-30)34(35(40)43-36(4,5)6)32-23-29(37)17-18-31(32)33-12-8-10-22-42-33/h13,15,17-18,23,26,30,33-34,38H,1,7-12,14,16,19-22,24H2,2-6H3/b15-13- |
| InChIKey | OCUMFEVNCVREQW-SQFISAMPSA-N |
| XLogP | 7.87 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.83 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|