C35H50FN3O5 — CID 146417282
tert-butyl 2-[5-fluoro-2-[(2S)-oxan-2-yl]phenyl]-2-[(3R)-3-[4-(4-methoxy-7-methyl-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetate (PubChem CID 146417282) has the molecular formula C35H50FN3O5 and a molecular weight of 611.80 g/mol. Its IUPAC name is tert-butyl 2-[5-fluoro-2-[(2S)-oxan-2-yl]phenyl]-2-[(3R)-3-[4-(4-methoxy-7-methyl-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetate.
| Compound Name | tert-butyl 2-[5-fluoro-2-[(2S)-oxan-2-yl]phenyl]-2-[(3R)-3-[4-(4-methoxy-7-methyl-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetate |
|---|---|
| PubChem CID | 146417282 |
| Molecular Formula | C35H50FN3O5 |
| Molecular Weight | 611.80 g/mol |
| Exact Mass | 611.37 |
| IUPAC Name | tert-butyl 2-[5-fluoro-2-[(2S)-oxan-2-yl]phenyl]-2-[(3R)-3-[4-(4-methoxy-7-methyl-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetate |
| SMILES | COc1cc(CCCCO[C@@H]2CCN(C(C(=O)OC(C)(C)C)c3cc(F)ccc3[C@@H]3CCCCO3)C2)nc2c1CCC(C)N2 |
| InChI | InChI=1S/C35H50FN3O5/c1-23-12-14-28-31(41-5)21-25(38-33(28)37-23)10-6-8-18-42-26-16-17-39(22-26)32(34(40)44-35(2,3)4)29-20-24(36)13-15-27(29)30-11-7-9-19-43-30/h13,15,20-21,23,26,30,32H,6-12,14,16-19,22H2,1-5H3,(H,37,38)/t23?,26-,30+,32?/m1/s1 |
| InChIKey | ZRMPOGHCXPULCA-VQFZXFANSA-N |
| XLogP | 6.71 |
| TPSA | 82.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.80 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|