C18H13ClF4N2O — CID 146433212
4-[4-[(4-chlorophenyl)methoxy]-2-fluorophenyl]-1-methyl-3-(trifluoromethyl)pyrazole (PubChem CID 146433212) has the molecular formula C18H13ClF4N2O and a molecular weight of 384.76 g/mol. Its IUPAC name is 4-[4-[(4-chlorophenyl)methoxy]-2-fluorophenyl]-1-methyl-3-(trifluoromethyl)pyrazole.
| Compound Name | 4-[4-[(4-chlorophenyl)methoxy]-2-fluorophenyl]-1-methyl-3-(trifluoromethyl)pyrazole |
|---|---|
| PubChem CID | 146433212 |
| Molecular Formula | C18H13ClF4N2O |
| Molecular Weight | 384.76 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | 4-[4-[(4-chlorophenyl)methoxy]-2-fluorophenyl]-1-methyl-3-(trifluoromethyl)pyrazole |
| SMILES | Cn1cc(-c2ccc(OCc3ccc(Cl)cc3)cc2F)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C18H13ClF4N2O/c1-25-9-15(17(24-25)18(21,22)23)14-7-6-13(8-16(14)20)26-10-11-2-4-12(19)5-3-11/h2-9H,10H2,1H3 |
| InChIKey | NDBWEXVZEITRHO-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.76 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |