About chromium;2-[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]-5-(phenylmethoxy)pyridine
chromium;2-[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]-5-(phenylmethoxy)pyridine (PubChem CID 155745979) has the molecular formula C17H13CrF3N3O-
and a molecular weight of 384.30 g/mol. Its IUPAC name is chromium;2-[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]-5-(phenylmethoxy)pyridine.
Molecular Properties
| Compound Name | chromium;2-[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]-5-(phenylmethoxy)pyridine |
| PubChem CID | 155745979 |
| Molecular Formula | C17H13CrF3N3O- |
| Molecular Weight | 384.30 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | chromium;2-[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]-5-(phenylmethoxy)pyridine |
| SMILES | Cn1cc(-c2ccc(OCc3cc[c-]cc3)cn2)c(C(F)(F)F)n1.[Cr] |
| InChI | InChI=1S/C17H13F3N3O.Cr/c1-23-10-14(16(22-23)17(18,19)20)15-8-7-13(9-21-15)24-11-12-5-3-2-4-6-12;/h3-10H,11H2,1H3;/q-1; |
| InChIKey | KMRDORGUIWJJOJ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.30 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze chromium;2-[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]-5-(phenylmethoxy)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chromium;2-[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]-5-(phenylmethoxy)pyridine?
The IUPAC name of chromium;2-[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]-5-(phenylmethoxy)pyridine (CID 155745979) is chromium;2-[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]-5-(phenylmethoxy)pyridine.
What is the SMILES notation for chromium;2-[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]-5-(phenylmethoxy)pyridine?
The canonical SMILES for chromium;2-[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]-5-(phenylmethoxy)pyridine is Cn1cc(-c2ccc(OCc3cc[c-]cc3)cn2)c(C(F)(F)F)n1.[Cr].
What is the InChIKey of chromium;2-[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]-5-(phenylmethoxy)pyridine?
The InChIKey is KMRDORGUIWJJOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13F3N3O.Cr/c1-23-10-14(16(22-23)17(18,19)20)15-8-7-13(9-21-15)24-11-12-5-3-2-4-6-12;/h3-10H,11H2,1H3;/q-1;.
What are the key properties of chromium;2-[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]-5-(phenylmethoxy)pyridine?
chromium;2-[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]-5-(phenylmethoxy)pyridine has a molecular weight of 384.30 g/mol, XLogP of 3.88, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for chromium;2-[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]-5-(phenylmethoxy)pyridine is sourced from PubChem (CID 155745979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).