C16H12CrF3N4O- — CID 155745982
chromium;2-[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]-5-(phenylmethoxy)pyrazine (PubChem CID 155745982) has the molecular formula C16H12CrF3N4O- and a molecular weight of 385.29 g/mol. Its IUPAC name is chromium;2-[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]-5-(phenylmethoxy)pyrazine.
| Compound Name | chromium;2-[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]-5-(phenylmethoxy)pyrazine |
|---|---|
| PubChem CID | 155745982 |
| Molecular Formula | C16H12CrF3N4O- |
| Molecular Weight | 385.29 g/mol |
| Exact Mass | 385.04 |
| IUPAC Name | chromium;2-[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]-5-(phenylmethoxy)pyrazine |
| SMILES | Cn1cc(-c2cnc(OCc3cc[c-]cc3)cn2)c(C(F)(F)F)n1.[Cr] |
| InChI | InChI=1S/C16H12F3N4O.Cr/c1-23-9-12(15(22-23)16(17,18)19)13-7-21-14(8-20-13)24-10-11-5-3-2-4-6-11;/h3-9H,10H2,1H3;/q-1; |
| InChIKey | CEUNSERTZPTGEG-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.29 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|