C64H42O8 — CID 146437741
[4-[(E)-3-[1-[2-[(E)-3-(4-benzoyloxyphenyl)prop-2-enoyl]oxy-3-phenylnaphthalen-1-yl]-3-phenylnaphthalen-2-yl]oxy-3-oxoprop-1-enyl]phenyl] benzoate (PubChem CID 146437741) has the molecular formula C64H42O8 and a molecular weight of 939.03 g/mol. Its IUPAC name is [4-[(E)-3-[1-[2-[(E)-3-(4-benzoyloxyphenyl)prop-2-enoyl]oxy-3-phenylnaphthalen-1-yl]-3-phenylnaphthalen-2-yl]oxy-3-oxoprop-1-enyl]phenyl] benzoate.
| Compound Name | [4-[(E)-3-[1-[2-[(E)-3-(4-benzoyloxyphenyl)prop-2-enoyl]oxy-3-phenylnaphthalen-1-yl]-3-phenylnaphthalen-2-yl]oxy-3-oxoprop-1-enyl]phenyl] benzoate |
|---|---|
| PubChem CID | 146437741 |
| Molecular Formula | C64H42O8 |
| Molecular Weight | 939.03 g/mol |
| Exact Mass | 938.29 |
| IUPAC Name | [4-[(E)-3-[1-[2-[(E)-3-(4-benzoyloxyphenyl)prop-2-enoyl]oxy-3-phenylnaphthalen-1-yl]-3-phenylnaphthalen-2-yl]oxy-3-oxoprop-1-enyl]phenyl] benzoate |
| SMILES | O=C(/C=C/c1ccc(OC(=O)c2ccccc2)cc1)Oc1c(-c2ccccc2)cc2ccccc2c1-c1c(OC(=O)/C=C/c2ccc(OC(=O)c3ccccc3)cc2)c(-c2ccccc2)cc2ccccc12 |
| InChI | InChI=1S/C64H42O8/c65-57(39-33-43-29-35-51(36-30-43)69-63(67)47-21-9-3-10-22-47)71-61-55(45-17-5-1-6-18-45)41-49-25-13-15-27-53(49)59(61)60-54-28-16-14-26-50(54)42-56(46-19-7-2-8-20-46)62(60)72-58(66)40-34-44-31-37-52(38-32-44)70-64(68)48-23-11-4-12-24-48/h1-42H/b39-33+,40-34+ |
| InChIKey | GBMQWPIXOTUVED-CFTRLRGZSA-N |
| XLogP | 14.67 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 939.03 |
| LogP ≤ 5 | 14.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|