C28H25N3O7 — CID 146438527
2-[(2,6-dioxo-4-phenylcyclohexylidene)methoxy]-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]acetamide (PubChem CID 146438527) has the molecular formula C28H25N3O7 and a molecular weight of 515.52 g/mol. Its IUPAC name is 2-[(2,6-dioxo-4-phenylcyclohexylidene)methoxy]-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]acetamide.
| Compound Name | 2-[(2,6-dioxo-4-phenylcyclohexylidene)methoxy]-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]acetamide |
|---|---|
| PubChem CID | 146438527 |
| Molecular Formula | C28H25N3O7 |
| Molecular Weight | 515.52 g/mol |
| Exact Mass | 515.17 |
| IUPAC Name | 2-[(2,6-dioxo-4-phenylcyclohexylidene)methoxy]-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]acetamide |
| SMILES | O=C1CCC(N2Cc3c(NC(=O)COC=C4C(=O)CC(c5ccccc5)CC4=O)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C28H25N3O7/c32-23-11-17(16-5-2-1-3-6-16)12-24(33)20(23)14-38-15-26(35)29-21-8-4-7-18-19(21)13-31(28(18)37)22-9-10-25(34)30-27(22)36/h1-8,14,17,22H,9-13,15H2,(H,29,35)(H,30,34,36)/b20-14- |
| InChIKey | GSANERHRXBCQFZ-ZHZULCJRSA-N |
| XLogP | 2.00 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.52 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|