C29H30N4O6 — CID 146438362
N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]-3-[[(E)-(2-hydroxy-6-oxo-4-phenylcyclohexylidene)methyl]amino]propanamide (PubChem CID 146438362) has the molecular formula C29H30N4O6 and a molecular weight of 530.58 g/mol. Its IUPAC name is N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]-3-[[(E)-(2-hydroxy-6-oxo-4-phenylcyclohexylidene)methyl]amino]propanamide.
| Compound Name | N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]-3-[[(E)-(2-hydroxy-6-oxo-4-phenylcyclohexylidene)methyl]amino]propanamide |
|---|---|
| PubChem CID | 146438362 |
| Molecular Formula | C29H30N4O6 |
| Molecular Weight | 530.58 g/mol |
| Exact Mass | 530.22 |
| IUPAC Name | N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]-3-[[(E)-(2-hydroxy-6-oxo-4-phenylcyclohexylidene)methyl]amino]propanamide |
| SMILES | O=C1CCC(N2Cc3c(NC(=O)CCN/C=C4/C(=O)CC(c5ccccc5)CC4O)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C29H30N4O6/c34-24-13-18(17-5-2-1-3-6-17)14-25(35)20(24)15-30-12-11-27(37)31-22-8-4-7-19-21(22)16-33(29(19)39)23-9-10-26(36)32-28(23)38/h1-8,15,18,23-24,30,34H,9-14,16H2,(H,31,37)(H,32,36,38)/b20-15+ |
| InChIKey | OWCPVMQFRVANAX-HMMYKYKNSA-N |
| XLogP | 1.76 |
| TPSA | 144.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.58 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|