C28H26N4O6 — CID 146438189
N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]-2-[(2-hydroxy-6-oxo-4-phenylcyclohexen-1-yl)methylideneamino]acetamide (PubChem CID 146438189) has the molecular formula C28H26N4O6 and a molecular weight of 514.54 g/mol. Its IUPAC name is N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]-2-[(2-hydroxy-6-oxo-4-phenylcyclohexen-1-yl)methylideneamino]acetamide.
| Compound Name | N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]-2-[(2-hydroxy-6-oxo-4-phenylcyclohexen-1-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 146438189 |
| Molecular Formula | C28H26N4O6 |
| Molecular Weight | 514.54 g/mol |
| Exact Mass | 514.19 |
| IUPAC Name | N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]-2-[(2-hydroxy-6-oxo-4-phenylcyclohexen-1-yl)methylideneamino]acetamide |
| SMILES | O=C1CCC(N2Cc3c(NC(=O)C/N=C/C4=C(O)CC(c5ccccc5)CC4=O)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C28H26N4O6/c33-23-11-17(16-5-2-1-3-6-16)12-24(34)19(23)13-29-14-26(36)30-21-8-4-7-18-20(21)15-32(28(18)38)22-9-10-25(35)31-27(22)37/h1-8,13,17,22,33H,9-12,14-15H2,(H,30,36)(H,31,35,37)/b29-13+ |
| InChIKey | YXMJVEZHFKCQSJ-VFLNYLIXSA-N |
| XLogP | 2.42 |
| TPSA | 145.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.54 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|