C26H23N3O6 — CID 146438214
3-[7-[[2-hydroxy-4-(4-hydroxyphenyl)-6-oxocyclohexen-1-yl]methylideneamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 146438214) has the molecular formula C26H23N3O6 and a molecular weight of 473.49 g/mol. Its IUPAC name is 3-[7-[[2-hydroxy-4-(4-hydroxyphenyl)-6-oxocyclohexen-1-yl]methylideneamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[[2-hydroxy-4-(4-hydroxyphenyl)-6-oxocyclohexen-1-yl]methylideneamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 146438214 |
| Molecular Formula | C26H23N3O6 |
| Molecular Weight | 473.49 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | 3-[7-[[2-hydroxy-4-(4-hydroxyphenyl)-6-oxocyclohexen-1-yl]methylideneamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(/N=C/C4=C(O)CC(c5ccc(O)cc5)CC4=O)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C26H23N3O6/c30-16-6-4-14(5-7-16)15-10-22(31)18(23(32)11-15)12-27-20-3-1-2-17-19(20)13-29(26(17)35)21-8-9-24(33)28-25(21)34/h1-7,12,15,21,30-31H,8-11,13H2,(H,28,33,34)/b27-12+ |
| InChIKey | QNEJICNCEONQOB-KKMKTNMSSA-N |
| XLogP | 2.81 |
| TPSA | 136.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.49 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|