C29H27N3O6 — CID 158175892
3-[7-[[2-hydroxy-6-oxo-4-[2-(2-oxopropyl)phenyl]cyclohexen-1-yl]methylideneamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 158175892) has the molecular formula C29H27N3O6 and a molecular weight of 513.55 g/mol. Its IUPAC name is 3-[7-[[2-hydroxy-6-oxo-4-[2-(2-oxopropyl)phenyl]cyclohexen-1-yl]methylideneamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[[2-hydroxy-6-oxo-4-[2-(2-oxopropyl)phenyl]cyclohexen-1-yl]methylideneamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 158175892 |
| Molecular Formula | C29H27N3O6 |
| Molecular Weight | 513.55 g/mol |
| Exact Mass | 513.19 |
| IUPAC Name | 3-[7-[[2-hydroxy-6-oxo-4-[2-(2-oxopropyl)phenyl]cyclohexen-1-yl]methylideneamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CC(=O)Cc1ccccc1C1CC(=O)C(/C=N/c2cccc3c2CN(C2CCC(=O)NC2=O)C3=O)=C(O)C1 |
| InChI | InChI=1S/C29H27N3O6/c1-16(33)11-17-5-2-3-6-19(17)18-12-25(34)21(26(35)13-18)14-30-23-8-4-7-20-22(23)15-32(29(20)38)24-9-10-27(36)31-28(24)37/h2-8,14,18,24,34H,9-13,15H2,1H3,(H,31,36,37)/b30-14+ |
| InChIKey | GYUVQIKUAUEIEU-AMVVHIIESA-N |
| XLogP | 3.24 |
| TPSA | 133.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.55 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|