C21H24ClN5S2 — CID 146439281
N-[[6-[(1-benzylpiperidin-4-yl)-methylamino]-5-chloro-3-pyridinyl]sulfanyl]-1,3-thiazol-4-amine (PubChem CID 146439281) has the molecular formula C21H24ClN5S2 and a molecular weight of 446.05 g/mol. Its IUPAC name is N-[[6-[(1-benzylpiperidin-4-yl)-methylamino]-5-chloro-3-pyridinyl]sulfanyl]-1,3-thiazol-4-amine.
| Compound Name | N-[[6-[(1-benzylpiperidin-4-yl)-methylamino]-5-chloro-3-pyridinyl]sulfanyl]-1,3-thiazol-4-amine |
|---|---|
| PubChem CID | 146439281 |
| Molecular Formula | C21H24ClN5S2 |
| Molecular Weight | 446.05 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | N-[[6-[(1-benzylpiperidin-4-yl)-methylamino]-5-chloro-3-pyridinyl]sulfanyl]-1,3-thiazol-4-amine |
| SMILES | CN(c1ncc(SNc2cscn2)cc1Cl)C1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H24ClN5S2/c1-26(17-7-9-27(10-8-17)13-16-5-3-2-4-6-16)21-19(22)11-18(12-23-21)29-25-20-14-28-15-24-20/h2-6,11-12,14-15,17,25H,7-10,13H2,1H3 |
| InChIKey | PXZHWGVDDAZPOZ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.05 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|