C19H22N8 — CID 146440365
N'-[amino(propan-2-yl)amino]-4-[(3H-benzimidazol-5-ylamino)-cyanomethyl]benzenecarboximidamide (PubChem CID 146440365) has the molecular formula C19H22N8 and a molecular weight of 362.44 g/mol. Its IUPAC name is N'-[amino(propan-2-yl)amino]-4-[(3H-benzimidazol-5-ylamino)-cyanomethyl]benzenecarboximidamide.
| Compound Name | N'-[amino(propan-2-yl)amino]-4-[(3H-benzimidazol-5-ylamino)-cyanomethyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 146440365 |
| Molecular Formula | C19H22N8 |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | N'-[amino(propan-2-yl)amino]-4-[(3H-benzimidazol-5-ylamino)-cyanomethyl]benzenecarboximidamide |
| SMILES | CC(C)N(N)/N=C(\N)c1ccc(C(C#N)Nc2ccc3nc[nH]c3c2)cc1 |
| InChI | InChI=1S/C19H22N8/c1-12(2)27(22)26-19(21)14-5-3-13(4-6-14)18(10-20)25-15-7-8-16-17(9-15)24-11-23-16/h3-9,11-12,18,25H,22H2,1-2H3,(H2,21,26)(H,23,24) |
| InChIKey | JJEFIQDUMKZMPG-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 132.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|