C25H31ClN4O — CID 146441023
4-[4-(tert-butylamino)piperidin-1-yl]-2-[(4-chlorophenyl)methylamino]quinolin-8-ol (PubChem CID 146441023) has the molecular formula C25H31ClN4O and a molecular weight of 439.00 g/mol. Its IUPAC name is 4-[4-(tert-butylamino)piperidin-1-yl]-2-[(4-chlorophenyl)methylamino]quinolin-8-ol.
| Compound Name | 4-[4-(tert-butylamino)piperidin-1-yl]-2-[(4-chlorophenyl)methylamino]quinolin-8-ol |
|---|---|
| PubChem CID | 146441023 |
| Molecular Formula | C25H31ClN4O |
| Molecular Weight | 439.00 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | 4-[4-(tert-butylamino)piperidin-1-yl]-2-[(4-chlorophenyl)methylamino]quinolin-8-ol |
| SMILES | CC(C)(C)NC1CCN(c2cc(NCc3ccc(Cl)cc3)nc3c(O)cccc23)CC1 |
| InChI | InChI=1S/C25H31ClN4O/c1-25(2,3)29-19-11-13-30(14-12-19)21-15-23(27-16-17-7-9-18(26)10-8-17)28-24-20(21)5-4-6-22(24)31/h4-10,15,19,29,31H,11-14,16H2,1-3H3,(H,27,28) |
| InChIKey | RXUSVOQQHSWORS-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 60.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.00 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |