C24H28ClN3 — CID 86273574
N-tert-butyl-1-[2-(4-chlorophenyl)quinolin-4-yl]piperidin-4-amine (PubChem CID 86273574) has the molecular formula C24H28ClN3 and a molecular weight of 393.96 g/mol. Its IUPAC name is N-tert-butyl-1-[2-(4-chlorophenyl)quinolin-4-yl]piperidin-4-amine.
| Compound Name | N-tert-butyl-1-[2-(4-chlorophenyl)quinolin-4-yl]piperidin-4-amine |
|---|---|
| PubChem CID | 86273574 |
| Molecular Formula | C24H28ClN3 |
| Molecular Weight | 393.96 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | N-tert-butyl-1-[2-(4-chlorophenyl)quinolin-4-yl]piperidin-4-amine |
| SMILES | CC(C)(C)NC1CCN(c2cc(-c3ccc(Cl)cc3)nc3ccccc23)CC1 |
| InChI | InChI=1S/C24H28ClN3/c1-24(2,3)27-19-12-14-28(15-13-19)23-16-22(17-8-10-18(25)11-9-17)26-21-7-5-4-6-20(21)23/h4-11,16,19,27H,12-15H2,1-3H3 |
| InChIKey | QKJSGQLRWYZZSC-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.96 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |