C50H64N8O2 — CID 158845027
4-[[[4-[4-(tert-butylamino)piperidin-1-yl]quinolin-2-yl]amino]methyl]phenol (PubChem CID 158845027) has the molecular formula C50H64N8O2 and a molecular weight of 809.12 g/mol. Its IUPAC name is 4-[[[4-[4-(tert-butylamino)piperidin-1-yl]quinolin-2-yl]amino]methyl]phenol.
| Compound Name | 4-[[[4-[4-(tert-butylamino)piperidin-1-yl]quinolin-2-yl]amino]methyl]phenol |
|---|---|
| PubChem CID | 158845027 |
| Molecular Formula | C50H64N8O2 |
| Molecular Weight | 809.12 g/mol |
| Exact Mass | 808.52 |
| IUPAC Name | 4-[[[4-[4-(tert-butylamino)piperidin-1-yl]quinolin-2-yl]amino]methyl]phenol |
| SMILES | CC(C)(C)NC1CCN(c2cc(NCc3ccc(O)cc3)nc3ccccc23)CC1.CC(C)(C)NC1CCN(c2cc(NCc3ccc(O)cc3)nc3ccccc23)CC1 |
| InChI | InChI=1S/2C25H32N4O/c2*1-25(2,3)28-19-12-14-29(15-13-19)23-16-24(27-22-7-5-4-6-21(22)23)26-17-18-8-10-20(30)11-9-18/h2*4-11,16,19,28,30H,12-15,17H2,1-3H3,(H,26,27) |
| InChIKey | IYSGHWLSDKCRAL-UHFFFAOYSA-N |
| XLogP | 9.82 |
| TPSA | 120.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.12 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |