C21H16IN3S — CID 146441256
2-[4-(3-iodophenyl)-5-pyridin-4-yl-1H-imidazol-2-yl]-5-methylbenzenethiol (PubChem CID 146441256) has the molecular formula C21H16IN3S and a molecular weight of 469.35 g/mol. Its IUPAC name is 2-[4-(3-iodophenyl)-5-pyridin-4-yl-1H-imidazol-2-yl]-5-methylbenzenethiol.
| Compound Name | 2-[4-(3-iodophenyl)-5-pyridin-4-yl-1H-imidazol-2-yl]-5-methylbenzenethiol |
|---|---|
| PubChem CID | 146441256 |
| Molecular Formula | C21H16IN3S |
| Molecular Weight | 469.35 g/mol |
| Exact Mass | 469.01 |
| IUPAC Name | 2-[4-(3-iodophenyl)-5-pyridin-4-yl-1H-imidazol-2-yl]-5-methylbenzenethiol |
| SMILES | Cc1ccc(-c2nc(-c3cccc(I)c3)c(-c3ccncc3)[nH]2)c(S)c1 |
| InChI | InChI=1S/C21H16IN3S/c1-13-5-6-17(18(26)11-13)21-24-19(14-7-9-23-10-8-14)20(25-21)15-3-2-4-16(22)12-15/h2-12,26H,1H3,(H,24,25) |
| InChIKey | AGMYPMOKBDMHGJ-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.35 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|