C17H18N2O7S — CID 146442876
N-[(4R,7R,9R,11S)-11-hydroxy-9-methyl-2-oxo-3-oxatricyclo[5.3.1.04,11]undec-1(10)-en-9-yl]-4-nitrobenzenesulfonamide (PubChem CID 146442876) has the molecular formula C17H18N2O7S and a molecular weight of 394.41 g/mol. Its IUPAC name is N-[(4R,7R,9R,11S)-11-hydroxy-9-methyl-2-oxo-3-oxatricyclo[5.3.1.04,11]undec-1(10)-en-9-yl]-4-nitrobenzenesulfonamide.
| Compound Name | N-[(4R,7R,9R,11S)-11-hydroxy-9-methyl-2-oxo-3-oxatricyclo[5.3.1.04,11]undec-1(10)-en-9-yl]-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 146442876 |
| Molecular Formula | C17H18N2O7S |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | N-[(4R,7R,9R,11S)-11-hydroxy-9-methyl-2-oxo-3-oxatricyclo[5.3.1.04,11]undec-1(10)-en-9-yl]-4-nitrobenzenesulfonamide |
| SMILES | C[C@]1(NS(=O)(=O)c2ccc([N+](=O)[O-])cc2)C=C2C(=O)O[C@@H]3CC[C@H](C1)[C@]23O |
| InChI | InChI=1S/C17H18N2O7S/c1-16(18-27(24,25)12-5-3-11(4-6-12)19(22)23)8-10-2-7-14-17(10,21)13(9-16)15(20)26-14/h3-6,9-10,14,18,21H,2,7-8H2,1H3/t10-,14-,16-,17+/m1/s1 |
| InChIKey | CZDIAZHJVNUDEL-AIPUMIGSSA-N |
| XLogP | 1.03 |
| TPSA | 135.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|