C27H26FN3O5 — CID 146448747
[3-cyano-2-[4-(dimethylamino)-1-(4-fluorophenyl)-1-hydroxybutyl]phenyl]methyl 4-nitrobenzoate (PubChem CID 146448747) has the molecular formula C27H26FN3O5 and a molecular weight of 491.52 g/mol. Its IUPAC name is [3-cyano-2-[4-(dimethylamino)-1-(4-fluorophenyl)-1-hydroxybutyl]phenyl]methyl 4-nitrobenzoate.
| Compound Name | [3-cyano-2-[4-(dimethylamino)-1-(4-fluorophenyl)-1-hydroxybutyl]phenyl]methyl 4-nitrobenzoate |
|---|---|
| PubChem CID | 146448747 |
| Molecular Formula | C27H26FN3O5 |
| Molecular Weight | 491.52 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | [3-cyano-2-[4-(dimethylamino)-1-(4-fluorophenyl)-1-hydroxybutyl]phenyl]methyl 4-nitrobenzoate |
| SMILES | CN(C)CCCC(O)(c1ccc(F)cc1)c1c(C#N)cccc1COC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H26FN3O5/c1-30(2)16-4-15-27(33,22-9-11-23(28)12-10-22)25-20(17-29)5-3-6-21(25)18-36-26(32)19-7-13-24(14-8-19)31(34)35/h3,5-14,33H,4,15-16,18H2,1-2H3 |
| InChIKey | KMVGTNDROZORCO-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 116.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.52 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|