C35H40N4O4 — CID 146449190
(3R,4S,8R,9S,10S)-N-(4-cyclopropyloxyphenyl)-10-[(dimethylamino)methyl]-3,4-dihydroxy-9-[4-(2-phenylethynyl)phenyl]-1,6-diazabicyclo[6.2.0]decane-6-carboxamide (PubChem CID 146449190) has the molecular formula C35H40N4O4 and a molecular weight of 580.73 g/mol. Its IUPAC name is (3R,4S,8R,9S,10S)-N-(4-cyclopropyloxyphenyl)-10-[(dimethylamino)methyl]-3,4-dihydroxy-9-[4-(2-phenylethynyl)phenyl]-1,6-diazabicyclo[6.2.0]decane-6-carboxamide.
| Compound Name | (3R,4S,8R,9S,10S)-N-(4-cyclopropyloxyphenyl)-10-[(dimethylamino)methyl]-3,4-dihydroxy-9-[4-(2-phenylethynyl)phenyl]-1,6-diazabicyclo[6.2.0]decane-6-carboxamide |
|---|---|
| PubChem CID | 146449190 |
| Molecular Formula | C35H40N4O4 |
| Molecular Weight | 580.73 g/mol |
| Exact Mass | 580.30 |
| IUPAC Name | (3R,4S,8R,9S,10S)-N-(4-cyclopropyloxyphenyl)-10-[(dimethylamino)methyl]-3,4-dihydroxy-9-[4-(2-phenylethynyl)phenyl]-1,6-diazabicyclo[6.2.0]decane-6-carboxamide |
| SMILES | CN(C)C[C@@H]1[C@H](c2ccc(C#Cc3ccccc3)cc2)[C@@H]2CN(C(=O)Nc3ccc(OC4CC4)cc3)C[C@H](O)[C@H](O)CN12 |
| InChI | InChI=1S/C35H40N4O4/c1-37(2)20-30-34(26-12-10-25(11-13-26)9-8-24-6-4-3-5-7-24)31-21-38(22-32(40)33(41)23-39(30)31)35(42)36-27-14-16-28(17-15-27)43-29-18-19-29/h3-7,10-17,29-34,40-41H,18-23H2,1-2H3,(H,36,42)/t30-,31+,32+,33-,34+/m1/s1 |
| InChIKey | IQMLGRAUTCZCJJ-YODGASFJSA-N |
| XLogP | 3.60 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.73 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|