C33H36F2N4O3 — CID 165070546
(3S,4R,8R,9S,10S)-9-[4-[2-(2,3-difluorophenyl)ethynyl]phenyl]-10-[(dimethylamino)methyl]-3,4-dihydroxy-N-(4-methylphenyl)-1,6-diazabicyclo[6.2.0]decane-6-carboxamide (PubChem CID 165070546) has the molecular formula C33H36F2N4O3 and a molecular weight of 574.67 g/mol. Its IUPAC name is (3S,4R,8R,9S,10S)-9-[4-[2-(2,3-difluorophenyl)ethynyl]phenyl]-10-[(dimethylamino)methyl]-3,4-dihydroxy-N-(4-methylphenyl)-1,6-diazabicyclo[6.2.0]decane-6-carboxamide.
| Compound Name | (3S,4R,8R,9S,10S)-9-[4-[2-(2,3-difluorophenyl)ethynyl]phenyl]-10-[(dimethylamino)methyl]-3,4-dihydroxy-N-(4-methylphenyl)-1,6-diazabicyclo[6.2.0]decane-6-carboxamide |
|---|---|
| PubChem CID | 165070546 |
| Molecular Formula | C33H36F2N4O3 |
| Molecular Weight | 574.67 g/mol |
| Exact Mass | 574.28 |
| IUPAC Name | (3S,4R,8R,9S,10S)-9-[4-[2-(2,3-difluorophenyl)ethynyl]phenyl]-10-[(dimethylamino)methyl]-3,4-dihydroxy-N-(4-methylphenyl)-1,6-diazabicyclo[6.2.0]decane-6-carboxamide |
| SMILES | Cc1ccc(NC(=O)N2C[C@@H](O)[C@@H](O)CN3[C@H](CN(C)C)[C@H](c4ccc(C#Cc5cccc(F)c5F)cc4)[C@@H]3C2)cc1 |
| InChI | InChI=1S/C33H36F2N4O3/c1-21-7-15-25(16-8-21)36-33(42)38-18-28-31(27(17-37(2)3)39(28)20-30(41)29(40)19-38)23-12-9-22(10-13-23)11-14-24-5-4-6-26(34)32(24)35/h4-10,12-13,15-16,27-31,40-41H,17-20H2,1-3H3,(H,36,42)/t27-,28+,29-,30+,31+/m1/s1 |
| InChIKey | VJMBSQMRSNTSJW-WUWJBHAQSA-N |
| XLogP | 3.64 |
| TPSA | 79.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.67 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|