C23H24O4 — CID 146453758
4-[3,5-dihydroxy-4-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]phenyl]benzoic acid (PubChem CID 146453758) has the molecular formula C23H24O4 and a molecular weight of 364.44 g/mol. Its IUPAC name is 4-[3,5-dihydroxy-4-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]phenyl]benzoic acid.
| Compound Name | 4-[3,5-dihydroxy-4-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 146453758 |
| Molecular Formula | C23H24O4 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 4-[3,5-dihydroxy-4-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]phenyl]benzoic acid |
| SMILES | C=C(C)[C@@H]1CCC(C)=C[C@H]1c1c(O)cc(-c2ccc(C(=O)O)cc2)cc1O |
| InChI | InChI=1S/C23H24O4/c1-13(2)18-9-4-14(3)10-19(18)22-20(24)11-17(12-21(22)25)15-5-7-16(8-6-15)23(26)27/h5-8,10-12,18-19,24-25H,1,4,9H2,2-3H3,(H,26,27)/t18-,19+/m0/s1 |
| InChIKey | IKBPXJIUUNCLCK-RBUKOAKNSA-N |
| XLogP | 5.48 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|