C33H30N2O4S — CID 146458332
1-[2-(1-naphthalen-2-yl-4-phenylcyclohexa-2,5-dien-1-yl)-2-oxoethyl]-5-pyrrolidin-1-ylsulfonylpyridin-2-one (PubChem CID 146458332) has the molecular formula C33H30N2O4S and a molecular weight of 550.68 g/mol. Its IUPAC name is 1-[2-(1-naphthalen-2-yl-4-phenylcyclohexa-2,5-dien-1-yl)-2-oxoethyl]-5-pyrrolidin-1-ylsulfonylpyridin-2-one.
| Compound Name | 1-[2-(1-naphthalen-2-yl-4-phenylcyclohexa-2,5-dien-1-yl)-2-oxoethyl]-5-pyrrolidin-1-ylsulfonylpyridin-2-one |
|---|---|
| PubChem CID | 146458332 |
| Molecular Formula | C33H30N2O4S |
| Molecular Weight | 550.68 g/mol |
| Exact Mass | 550.19 |
| IUPAC Name | 1-[2-(1-naphthalen-2-yl-4-phenylcyclohexa-2,5-dien-1-yl)-2-oxoethyl]-5-pyrrolidin-1-ylsulfonylpyridin-2-one |
| SMILES | O=C(Cn1cc(S(=O)(=O)N2CCCC2)ccc1=O)C1(c2ccc3ccccc3c2)C=CC(c2ccccc2)C=C1 |
| InChI | InChI=1S/C33H30N2O4S/c36-31(24-34-23-30(14-15-32(34)37)40(38,39)35-20-6-7-21-35)33(29-13-12-26-10-4-5-11-28(26)22-29)18-16-27(17-19-33)25-8-2-1-3-9-25/h1-5,8-19,22-23,27H,6-7,20-21,24H2 |
| InChIKey | RDOWKNNPTOHOBT-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 76.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.68 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|