C35H36N4O12S — CID 146458491
2-(2,6-dioxopiperidin-3-yl)-5-[2-[2-[2-[2-[2-[(7-nitro-10H-phenothiazin-3-yl)oxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]isoindole-1,3-dione (PubChem CID 146458491) has the molecular formula C35H36N4O12S and a molecular weight of 736.76 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[2-[2-[2-[2-[2-[(7-nitro-10H-phenothiazin-3-yl)oxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[2-[2-[2-[2-[2-[(7-nitro-10H-phenothiazin-3-yl)oxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 146458491 |
| Molecular Formula | C35H36N4O12S |
| Molecular Weight | 736.76 g/mol |
| Exact Mass | 736.21 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[2-[2-[2-[2-[2-[(7-nitro-10H-phenothiazin-3-yl)oxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(OCCOCCOCCOCCOCCOc4ccc5c(c4)Sc4cc([N+](=O)[O-])ccc4N5)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C35H36N4O12S/c40-32-8-7-29(33(41)37-32)38-34(42)25-4-2-23(20-26(25)35(38)43)50-17-15-48-13-11-46-9-10-47-12-14-49-16-18-51-24-3-6-28-31(21-24)52-30-19-22(39(44)45)1-5-27(30)36-28/h1-6,19-21,29,36H,7-18H2,(H,37,40,41) |
| InChIKey | JPDDDECUNXFDQV-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 194.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.76 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|