C41H34N4O10 — CID 146458514
2-(2,6-dioxopiperidin-3-yl)-5-[2-[2-[4-[[3-[(E)-3-(4-nitrophenyl)prop-2-enylidene]-2-oxoindol-1-yl]methyl]phenoxy]ethoxy]ethoxy]isoindole-1,3-dione (PubChem CID 146458514) has the molecular formula C41H34N4O10 and a molecular weight of 742.74 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[2-[2-[4-[[3-[(E)-3-(4-nitrophenyl)prop-2-enylidene]-2-oxoindol-1-yl]methyl]phenoxy]ethoxy]ethoxy]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[2-[2-[4-[[3-[(E)-3-(4-nitrophenyl)prop-2-enylidene]-2-oxoindol-1-yl]methyl]phenoxy]ethoxy]ethoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 146458514 |
| Molecular Formula | C41H34N4O10 |
| Molecular Weight | 742.74 g/mol |
| Exact Mass | 742.23 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[2-[2-[4-[[3-[(E)-3-(4-nitrophenyl)prop-2-enylidene]-2-oxoindol-1-yl]methyl]phenoxy]ethoxy]ethoxy]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(OCCOCCOc4ccc(CN5C(=O)C(=C/C=C/c6ccc([N+](=O)[O-])cc6)c6ccccc65)cc4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C41H34N4O10/c46-37-19-18-36(38(47)42-37)44-40(49)33-17-16-30(24-34(33)41(44)50)55-23-21-53-20-22-54-29-14-10-27(11-15-29)25-43-35-7-2-1-5-31(35)32(39(43)48)6-3-4-26-8-12-28(13-9-26)45(51)52/h1-17,24,36H,18-23,25H2,(H,42,46,47)/b4-3+,32-6? |
| InChIKey | FYMDWHZQLGYIDW-NQKQFBFLSA-N |
| XLogP | 5.11 |
| TPSA | 174.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.74 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|