C43H37ClN6O2S — CID 146459014
3-[[2-(2-chloro-5-tritylpyrrolo[2,3-b]pyrazin-7-yl)-6-(5-methylthiophen-2-yl)pyrimidin-4-yl]amino]bicyclo[2.2.2]octane-2-carboxylic acid (PubChem CID 146459014) has the molecular formula C43H37ClN6O2S and a molecular weight of 737.33 g/mol. Its IUPAC name is 3-[[2-(2-chloro-5-tritylpyrrolo[2,3-b]pyrazin-7-yl)-6-(5-methylthiophen-2-yl)pyrimidin-4-yl]amino]bicyclo[2.2.2]octane-2-carboxylic acid.
| Compound Name | 3-[[2-(2-chloro-5-tritylpyrrolo[2,3-b]pyrazin-7-yl)-6-(5-methylthiophen-2-yl)pyrimidin-4-yl]amino]bicyclo[2.2.2]octane-2-carboxylic acid |
|---|---|
| PubChem CID | 146459014 |
| Molecular Formula | C43H37ClN6O2S |
| Molecular Weight | 737.33 g/mol |
| Exact Mass | 736.24 |
| IUPAC Name | 3-[[2-(2-chloro-5-tritylpyrrolo[2,3-b]pyrazin-7-yl)-6-(5-methylthiophen-2-yl)pyrimidin-4-yl]amino]bicyclo[2.2.2]octane-2-carboxylic acid |
| SMILES | Cc1ccc(-c2cc(NC3C4CCC(CC4)C3C(=O)O)nc(-c3cn(C(c4ccccc4)(c4ccccc4)c4ccccc4)c4ncc(Cl)nc34)n2)s1 |
| InChI | InChI=1S/C43H37ClN6O2S/c1-26-17-22-34(53-26)33-23-36(48-38-28-20-18-27(19-21-28)37(38)42(51)52)49-40(46-33)32-25-50(41-39(32)47-35(44)24-45-41)43(29-11-5-2-6-12-29,30-13-7-3-8-14-30)31-15-9-4-10-16-31/h2-17,22-25,27-28,37-38H,18-21H2,1H3,(H,51,52)(H,46,48,49) |
| InChIKey | SCXRPPZBCDLTKD-UHFFFAOYSA-N |
| XLogP | 9.72 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.33 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|