C44H38ClFN6O2S — CID 175888128
ethyl (2R,3R)-3-[[2-(2-chloro-5-tritylpyrrolo[2,3-b]pyrazin-7-yl)-6-(5-fluorothiophen-2-yl)pyrimidin-4-yl]amino]bicyclo[2.2.2]octane-2-carboxylate (PubChem CID 175888128) has the molecular formula C44H38ClFN6O2S and a molecular weight of 769.35 g/mol. Its IUPAC name is ethyl (2R,3R)-3-[[2-(2-chloro-5-tritylpyrrolo[2,3-b]pyrazin-7-yl)-6-(5-fluorothiophen-2-yl)pyrimidin-4-yl]amino]bicyclo[2.2.2]octane-2-carboxylate.
| Compound Name | ethyl (2R,3R)-3-[[2-(2-chloro-5-tritylpyrrolo[2,3-b]pyrazin-7-yl)-6-(5-fluorothiophen-2-yl)pyrimidin-4-yl]amino]bicyclo[2.2.2]octane-2-carboxylate |
|---|---|
| PubChem CID | 175888128 |
| Molecular Formula | C44H38ClFN6O2S |
| Molecular Weight | 769.35 g/mol |
| Exact Mass | 768.24 |
| IUPAC Name | ethyl (2R,3R)-3-[[2-(2-chloro-5-tritylpyrrolo[2,3-b]pyrazin-7-yl)-6-(5-fluorothiophen-2-yl)pyrimidin-4-yl]amino]bicyclo[2.2.2]octane-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C2CCC(CC2)[C@H]1Nc1cc(-c2ccc(F)s2)nc(-c2cn(C(c3ccccc3)(c3ccccc3)c3ccccc3)c3ncc(Cl)nc23)n1 |
| InChI | InChI=1S/C44H38ClFN6O2S/c1-2-54-43(53)38-27-18-20-28(21-19-27)39(38)50-37-24-33(34-22-23-36(46)55-34)48-41(51-37)32-26-52(42-40(32)49-35(45)25-47-42)44(29-12-6-3-7-13-29,30-14-8-4-9-15-30)31-16-10-5-11-17-31/h3-17,22-28,38-39H,2,18-21H2,1H3,(H,48,50,51)/t27?,28?,38-,39-/m1/s1 |
| InChIKey | DYYUMIMJISNPGI-NKFOGOJDSA-N |
| XLogP | 10.03 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.35 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|