C23H29N5O5 — CID 146459759
2-[1-[6-cyano-1-(3-methylbutyl)-3-nitroindole-2-carbonyl]piperidin-4-yl]ethylcarbamic acid (PubChem CID 146459759) has the molecular formula C23H29N5O5 and a molecular weight of 455.52 g/mol. Its IUPAC name is 2-[1-[6-cyano-1-(3-methylbutyl)-3-nitroindole-2-carbonyl]piperidin-4-yl]ethylcarbamic acid.
| Compound Name | 2-[1-[6-cyano-1-(3-methylbutyl)-3-nitroindole-2-carbonyl]piperidin-4-yl]ethylcarbamic acid |
|---|---|
| PubChem CID | 146459759 |
| Molecular Formula | C23H29N5O5 |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | 2-[1-[6-cyano-1-(3-methylbutyl)-3-nitroindole-2-carbonyl]piperidin-4-yl]ethylcarbamic acid |
| SMILES | CC(C)CCn1c(C(=O)N2CCC(CCNC(=O)O)CC2)c([N+](=O)[O-])c2ccc(C#N)cc21 |
| InChI | InChI=1S/C23H29N5O5/c1-15(2)6-12-27-19-13-17(14-24)3-4-18(19)20(28(32)33)21(27)22(29)26-10-7-16(8-11-26)5-9-25-23(30)31/h3-4,13,15-16,25H,5-12H2,1-2H3,(H,30,31) |
| InChIKey | BBZWXMAJRWFYJZ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 141.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|