C18H19N5O5 — CID 146460037
2-[1-(6-cyano-3-nitro-1H-indole-2-carbonyl)piperidin-4-yl]ethylcarbamic acid (PubChem CID 146460037) has the molecular formula C18H19N5O5 and a molecular weight of 385.38 g/mol. Its IUPAC name is 2-[1-(6-cyano-3-nitro-1H-indole-2-carbonyl)piperidin-4-yl]ethylcarbamic acid.
| Compound Name | 2-[1-(6-cyano-3-nitro-1H-indole-2-carbonyl)piperidin-4-yl]ethylcarbamic acid |
|---|---|
| PubChem CID | 146460037 |
| Molecular Formula | C18H19N5O5 |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 2-[1-(6-cyano-3-nitro-1H-indole-2-carbonyl)piperidin-4-yl]ethylcarbamic acid |
| SMILES | N#Cc1ccc2c([N+](=O)[O-])c(C(=O)N3CCC(CCNC(=O)O)CC3)[nH]c2c1 |
| InChI | InChI=1S/C18H19N5O5/c19-10-12-1-2-13-14(9-12)21-15(16(13)23(27)28)17(24)22-7-4-11(5-8-22)3-6-20-18(25)26/h1-2,9,11,20-21H,3-8H2,(H,25,26) |
| InChIKey | OSIYBAAGJLQNFR-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 152.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|