C20H17ClN6O2 — CID 146461283
4-[(7S)-11-chloro-9-oxa-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18),15-pentaen-12-yl]-1,3-dihydrobenzimidazol-2-one (PubChem CID 146461283) has the molecular formula C20H17ClN6O2 and a molecular weight of 408.85 g/mol. Its IUPAC name is 4-[(7S)-11-chloro-9-oxa-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18),15-pentaen-12-yl]-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 4-[(7S)-11-chloro-9-oxa-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18),15-pentaen-12-yl]-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 146461283 |
| Molecular Formula | C20H17ClN6O2 |
| Molecular Weight | 408.85 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | 4-[(7S)-11-chloro-9-oxa-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18),15-pentaen-12-yl]-1,3-dihydrobenzimidazol-2-one |
| SMILES | O=c1[nH]c2cccc(-c3cc4ncnc5c4c(c3Cl)OC[C@@H]3CNCCN53)c2[nH]1 |
| InChI | InChI=1S/C20H17ClN6O2/c21-16-12(11-2-1-3-13-17(11)26-20(28)25-13)6-14-15-18(16)29-8-10-7-22-4-5-27(10)19(15)24-9-23-14/h1-3,6,9-10,22H,4-5,7-8H2,(H2,25,26,28)/t10-/m0/s1 |
| InChIKey | XUKXKUWZGKZIIV-JTQLQIEISA-N |
| XLogP | 2.29 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.85 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |